Products 690694-22-5
CAS 690694-22-5 is the registry number for 4-(4-Methoxy-3-methylphenyl)-N-(6-methylpyridin-2-yl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-methoxy-3-methylphenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine (CAS 690694-22-5) is a chemical compound with the molecular formula C17H17N3OS and a molecular weight of 311.4 g/mol. IUPAC name: 4-(4-methoxy-3-methylphenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine. InChIKey: GCJYJDOVBMBSCE-UHFFFAOYSA-N.
| Molecular formula | C17H17N3OS |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 4-(4-methoxy-3-methylphenyl)-N-(6-methyl-2-pyridinyl)-1,3-thiazol-2-amine |
| InChIKey | GCJYJDOVBMBSCE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)NC2=NC(=CS2)C3=CC(=C(C=C3)OC)C |
Computed by PubChem (NCBI)