CAS 170838-83-2 appears in our catalog under these names: 1,3-Piperidinedicarboxylic acid, 3-(phenylmethyl)-, 1-(1,1-dimethylethyl) ester, 98%, 98%, 1-Boc-3-benzyl-3-piperidinecarboxylic acid, 99.97%, 3-Benzyl-piperidine-1,3-dicarboxylic acid 1-tert-butyl ester, 98%, 3-Benzyl-1-(tert-butoxycarbonyl)piperidine-3-carboxylic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 100 mg, 500 mg, 1 g, 5 g.
3-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid (CAS 170838-83-2) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: 3-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid. InChIKey: SLWITFDUIZLEJL-UHFFFAOYSA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 3-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-3-carboxylic acid |
| InChIKey | SLWITFDUIZLEJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)