Products 1708818-36-3
CAS 1708818-36-3 appears in our catalog under these names: tert-Butyl 3-bromo-5-methylbenzoate, tert-Butyl 3-bromo-5-methylbenzoate, 95%, tert-Butyl 3-bromo-5-methylbenzoate, 98%, Tert-butyl 3-bromo-5-methylbenzoate, ≥95%, ≥95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 100mg, 5g.
Tert-butyl 3-bromo-5-methylbenzoate (CAS 1708818-36-3) is a chemical compound with the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. IUPAC name: tert-butyl 3-bromo-5-methylbenzoate. InChIKey: AJPMJEFTUYRKTP-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO2 |
|---|---|
| Molecular weight | 271.15 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-methylbenzoate |
| InChIKey | AJPMJEFTUYRKTP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)