CAS 1708930-15-7 appears in our catalog under these names: (R)-3-Hydroxy-1-(3-phenoxypropyl)quinuclidin-1-ium bromide, 98%, Aclidinium bromide Impurity 2, LAS-34823, >95% (HPLC), LAS-34823. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg.
(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-ol bromide (CAS 1708930-15-7) is a chemical compound with the molecular formula C16H24BrNO2 and a molecular weight of 342.27 g/mol. IUPAC name: (3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-ol bromide. InChIKey: OVZUMPBMNBEYDM-FPSFNUPFSA-M.
| Molecular formula | C16H24BrNO2 |
|---|---|
| Molecular weight | 342.27 g/mol |
| IUPAC name | (3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-ol bromide |
| InChIKey | OVZUMPBMNBEYDM-FPSFNUPFSA-M |
| SMILES | C1C[N+]2(CCC1[C@H](C2)O)CCCOC3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)