Products 2358751-29-6
CAS 2358751-29-6 is the registry number for tert-Butyl 4-bromo-2-methylbenzyl(isopropyl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-[(4-bromo-2-methylphenyl)methyl]-N-propan-2-ylcarbamate (CAS 2358751-29-6) is a chemical compound with the molecular formula C16H24BrNO2 and a molecular weight of 342.27 g/mol. IUPAC name: tert-butyl N-[(4-bromo-2-methylphenyl)methyl]-N-propan-2-ylcarbamate. InChIKey: BLAAZKOYZAKAFK-UHFFFAOYSA-N.
| Molecular formula | C16H24BrNO2 |
|---|---|
| Molecular weight | 342.27 g/mol |
| IUPAC name | tert-butyl N-[(4-bromo-2-methylphenyl)methyl]-N-propan-2-ylcarbamate |
| InChIKey | BLAAZKOYZAKAFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)CN(C(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)