CAS 170984-72-2 appears in our catalog under these names: (S)-2-Amino-2-ethylpentanedioic acid, 97%, EGLU, EGLU/ 99.98% (existing batch purity), EGLU, 99.79%. Offered by: Chemat Brand, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 5 mg.
(2S)-2-amino-2-ethylpentanedioic acid (CAS 170984-72-2) is a chemical compound with the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. IUPAC name: (2S)-2-amino-2-ethylpentanedioic acid. InChIKey: QFYBYZLHPIALCZ-ZETCQYMHSA-N.
| Molecular formula | C7H13NO4 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | (2S)-2-amino-2-ethylpentanedioic acid |
| InChIKey | QFYBYZLHPIALCZ-ZETCQYMHSA-N |
| SMILES | CC[C@](CCC(=O)O)(C(=O)O)N |
Computed by PubChem (NCBI)