CAS 1709905-39-4 appears in our catalog under these names: 8-Bromo-2-(methylthio)pyrido(4,3-d)pyrimidin-4(3H)-one, 95+%, 8-Bromo-2-(methylsulfanyl)-3H,4H-pyrido(4,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
8-bromo-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 1709905-39-4) is a chemical compound with the molecular formula C8H6BrN3OS and a molecular weight of 272.12 g/mol. IUPAC name: 8-bromo-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: STUVZQRVMLUERX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3OS |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 8-bromo-2-methylsulfanyl-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | STUVZQRVMLUERX-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C=NC=C2C(=O)N1)Br |
Computed by PubChem (NCBI)