Products 887584-46-5
CAS 887584-46-5 is the registry number for 5-(4-Amino-3-bromophenyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-amino-3-bromophenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 887584-46-5) is a chemical compound with the molecular formula C8H6BrN3OS and a molecular weight of 272.12 g/mol. IUPAC name: 5-(4-amino-3-bromophenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: IDLUZRNJZFOOSS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3OS |
|---|---|
| Molecular weight | 272.12 g/mol |
| IUPAC name | 5-(4-amino-3-bromophenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | IDLUZRNJZFOOSS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NNC(=S)O2)Br)N |
Computed by PubChem (NCBI)