CAS 1710439-51-2 is the registry number for 3-((5-Fluoro-2-nitrophenyl)methyl)-2,3-dihydro-1,3-thiazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(5-fluoro-2-nitrophenyl)methyl]-1,3-thiazol-2-one (CAS 1710439-51-2) is a chemical compound with the molecular formula C10H7FN2O3S and a molecular weight of 254.24 g/mol. IUPAC name: 3-[(5-fluoro-2-nitrophenyl)methyl]-1,3-thiazol-2-one. InChIKey: NRMPCRURFDHKFJ-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O3S |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 3-[(5-fluoro-2-nitrophenyl)methyl]-1,3-thiazol-2-one |
| InChIKey | NRMPCRURFDHKFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CN2C=CSC2=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)