CAS 485334-65-4 is the registry number for (5-(4-Fluoro-phenyl)-(1,3,4)oxadiazol-2-ylsulfanyl)-acetic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (CAS 485334-65-4) is a chemical compound with the molecular formula C10H7FN2O3S and a molecular weight of 254.24 g/mol. IUPAC name: 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid. InChIKey: HIAAWEVGYSBOCA-UHFFFAOYSA-N.
| Molecular formula | C10H7FN2O3S |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid |
| InChIKey | HIAAWEVGYSBOCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)SCC(=O)O)F |
Computed by PubChem (NCBI)