CAS 17107-25-4 is the registry number for 5-Phenyloxazol-2-ol, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
5-phenyl-3H-1,3-oxazol-2-one (CAS 17107-25-4) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 5-phenyl-3H-1,3-oxazol-2-one. InChIKey: YYKBLLMGKYDQLB-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 5-phenyl-3H-1,3-oxazol-2-one |
| InChIKey | YYKBLLMGKYDQLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=O)O2 |
Computed by PubChem (NCBI)