Products 1710765-32-4
CAS 1710765-32-4 is the registry number for Vildagliptin Related Compound 4. Offered by: Chemat Brand. Available pack sizes: on request.
(8aS)-2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one (CAS 1710765-32-4) is a chemical compound with the molecular formula C17H25N3O2 and a molecular weight of 303.4 g/mol. IUPAC name: (8aS)-2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one. InChIKey: ZZYCWDSBZNHPIN-FBXIQOIYSA-N.
| Molecular formula | C17H25N3O2 |
|---|---|
| Molecular weight | 303.4 g/mol |
| IUPAC name | (8aS)-2-(3-hydroxy-1-adamantyl)-1-imino-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-4-one |
| InChIKey | ZZYCWDSBZNHPIN-FBXIQOIYSA-N |
| SMILES | C1C[C@H]2C(=N)N(CC(=O)N2C1)C34CC5CC(C3)CC(C5)(C4)O |
Computed by PubChem (NCBI)