CAS 17115-47-8 appears in our catalog under these names: Tetrahydro-3-thiophenesulfonyl chloride 1,1-dioxide, 95%, Tetrahydrothiophene-3-sulfonyl chloride 1,1-dioxide, 97%, tetrahydrothiophene–3–sulfonyl chloride 1,1–dioxide, tetrahydrothiophene-3-sulfonyl chloride 1,1-dioxide, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1,1-dioxothiolane-3-sulfonyl chloride (CAS 17115-47-8) is a chemical compound with the molecular formula C4H7ClO4S2 and a molecular weight of 218.7 g/mol. IUPAC name: 1,1-dioxothiolane-3-sulfonyl chloride. InChIKey: AOAOPMCGCFWIHW-UHFFFAOYSA-N.
| Molecular formula | C4H7ClO4S2 |
|---|---|
| Molecular weight | 218.7 g/mol |
| IUPAC name | 1,1-dioxothiolane-3-sulfonyl chloride |
| InChIKey | AOAOPMCGCFWIHW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1S(=O)(=O)Cl |
Computed by PubChem (NCBI)