Products 2092099-08-4

CAS 2092099-08-4 appears in our catalog under these names: (1,1-Dioxo-1lambda6-thietan-3-yl)methanesulfonyl chloride, 95%, 3-​Thietanemethanesulfo​nyl chloride 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

(1,1-dioxothietan-3-yl)methanesulfonyl chloride (CAS 2092099-08-4) is a chemical compound with the molecular formula C4H7ClO4S2 and a molecular weight of 218.7 g/mol. IUPAC name: (1,1-dioxothietan-3-yl)methanesulfonyl chloride. InChIKey: KSDALRIWYAVHGP-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClO4S2
Molecular weight218.7 g/mol
IUPAC name(1,1-dioxothietan-3-yl)methanesulfonyl chloride
InChIKeyKSDALRIWYAVHGP-UHFFFAOYSA-N
SMILESC1C(CS1(=O)=O)CS(=O)(=O)Cl

Computed by PubChem (NCBI)