CAS 17115-48-9 is the registry number for Tetrahydrothiophene-3-sulfonamide 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
1,1-dioxothiolane-3-sulfonamide (CAS 17115-48-9) is a chemical compound with the molecular formula C4H9NO4S2 and a molecular weight of 199.3 g/mol. IUPAC name: 1,1-dioxothiolane-3-sulfonamide. InChIKey: BVMJOOFLVVQAET-UHFFFAOYSA-N.
| Molecular formula | C4H9NO4S2 |
|---|---|
| Molecular weight | 199.3 g/mol |
| IUPAC name | 1,1-dioxothiolane-3-sulfonamide |
| InChIKey | BVMJOOFLVVQAET-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1S(=O)(=O)N |
Computed by PubChem (NCBI)