Products 17115-48-9

CAS 17115-48-9 is the registry number for Tetrahydrothiophene-3-sulfonamide 1,1-dioxide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

1,1-dioxothiolane-3-sulfonamide (CAS 17115-48-9) is a chemical compound with the molecular formula C4H9NO4S2 and a molecular weight of 199.3 g/mol. IUPAC name: 1,1-dioxothiolane-3-sulfonamide. InChIKey: BVMJOOFLVVQAET-UHFFFAOYSA-N.

Identity
Molecular formulaC4H9NO4S2
Molecular weight199.3 g/mol
IUPAC name1,1-dioxothiolane-3-sulfonamide
InChIKeyBVMJOOFLVVQAET-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CC1S(=O)(=O)N

Computed by PubChem (NCBI)