CAS 351422-29-2 is the registry number for (R)-2-Amino-2-carboxyethylmethanethiosulfonate. Offered by: TRC. Available pack sizes: 10mg.
(2R)-2-amino-3-methylsulfonylsulfanylpropanoic acid (CAS 351422-29-2) is a chemical compound with the molecular formula C4H9NO4S2 and a molecular weight of 199.3 g/mol. IUPAC name: (2R)-2-amino-3-methylsulfonylsulfanylpropanoic acid. InChIKey: WQGAHEAQVIFZHB-VKHMYHEASA-N.
| Molecular formula | C4H9NO4S2 |
|---|---|
| Molecular weight | 199.3 g/mol |
| IUPAC name | (2R)-2-amino-3-methylsulfonylsulfanylpropanoic acid |
| InChIKey | WQGAHEAQVIFZHB-VKHMYHEASA-N |
| SMILES | CS(=O)(=O)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)