CAS 17117-72-5 appears in our catalog under these names: (2R,3S)-5-Hydroxy-2-(((4-methylbenzoyl)oxy)methyl)tetrahydrofuran-3-yl 4-methylbenzoate, 98%, Decitabine Impurity 3, rac-2-Deoxy-D-erythro-pentofuranose 3,5-Di-p-toluate(Decitabine Impurity). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
[(2R,3S)-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate (CAS 17117-72-5) is a chemical compound with the molecular formula C21H22O6 and a molecular weight of 370.4 g/mol. IUPAC name: [(2R,3S)-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate. InChIKey: HMTWHMYPWSAEHP-PAMZHZACSA-N.
| Molecular formula | C21H22O6 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | [(2R,3S)-5-hydroxy-3-(4-methylbenzoyl)oxyoxolan-2-yl]methyl 4-methylbenzoate |
| InChIKey | HMTWHMYPWSAEHP-PAMZHZACSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](CC(O2)O)OC(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)