Products 175030-48-5
CAS 175030-48-5 is the registry number for rac-Exiguaflavanone K. Offered by: TRC. Available pack sizes: 50mg.
5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one (CAS 175030-48-5) is a chemical compound with the molecular formula C21H22O6 and a molecular weight of 370.4 g/mol. IUPAC name: 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one. InChIKey: NSGZYFCJQNNTFB-UHFFFAOYSA-N.
| Molecular formula | C21H22O6 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
| InChIKey | NSGZYFCJQNNTFB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)CC(O2)C3=CC(=C(C=C3)O)OC)C |
Computed by PubChem (NCBI)