Products 171252-79-2
CAS 171252-79-2 is the registry number for YM-796 (dihydroxybutanedioate). Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R)-2,3-dihydroxybutanedioic acid;2,8-dimethyl-3-methylidene-1-oxa-8-azaspiro[4.5]decane (CAS 171252-79-2) is a chemical compound with the molecular formula C15H25NO7 and a molecular weight of 331.36 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;2,8-dimethyl-3-methylidene-1-oxa-8-azaspiro[4.5]decane. InChIKey: RMKUOCBJRZODFU-LREBCSMRSA-N.
| Molecular formula | C15H25NO7 |
|---|---|
| Molecular weight | 331.36 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;2,8-dimethyl-3-methylidene-1-oxa-8-azaspiro[4.5]decane |
| InChIKey | RMKUOCBJRZODFU-LREBCSMRSA-N |
| SMILES | CC1C(=C)CC2(O1)CCN(CC2)C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)