Products 2138182-03-1
CAS 2138182-03-1 is the registry number for 2,4-Bis((tert-butoxy)carbonyl)morpholine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid (CAS 2138182-03-1) is a chemical compound with the molecular formula C15H25NO7 and a molecular weight of 331.36 g/mol. IUPAC name: 2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid. InChIKey: DMRMLPTWDPYQOD-UHFFFAOYSA-N.
| Molecular formula | C15H25NO7 |
|---|---|
| Molecular weight | 331.36 g/mol |
| IUPAC name | 2,4-bis[(2-methylpropan-2-yl)oxycarbonyl]morpholine-2-carboxylic acid |
| InChIKey | DMRMLPTWDPYQOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1(CN(CCO1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)