CAS 17127-14-9 is the registry number for 1,4-Dichloropyridazino[4,5-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-dichloropyridazino[4,5-d]pyridazine (CAS 17127-14-9) is a chemical compound with the molecular formula C6H2Cl2N4 and a molecular weight of 201.01 g/mol. IUPAC name: 1,4-dichloropyridazino[4,5-d]pyridazine. InChIKey: FBEFUWIYQAXNAT-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N4 |
|---|---|
| Molecular weight | 201.01 g/mol |
| IUPAC name | 1,4-dichloropyridazino[4,5-d]pyridazine |
| InChIKey | FBEFUWIYQAXNAT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=N1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)