CAS 98138-05-7 appears in our catalog under these names: 2,4-Dichloropteridine, 95%, 2,4–Dichloropteridine, 2,4-Dichloropteridine 98%, 2,4-Dichloropteridine, 98%, 98%, 2,4-Dichloropteridine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 50mg, 100mg, 250mg.
2,4-dichloropteridine (CAS 98138-05-7) is a chemical compound with the molecular formula C6H2Cl2N4 and a molecular weight of 201.01 g/mol. IUPAC name: 2,4-dichloropteridine. InChIKey: WVSQXWZADZZUSV-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N4 |
|---|---|
| Molecular weight | 201.01 g/mol |
| IUPAC name | 2,4-dichloropteridine |
| InChIKey | WVSQXWZADZZUSV-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)