Products 171273-35-1
CAS 171273-35-1 appears in our catalog under these names: Brinzolamide Impurity 11, Brinzolamide Impurity C. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methoxypropyl)-1,1-dioxothieno[3,2-e]thiazine-6-sulfonamide (CAS 171273-35-1) is a chemical compound with the molecular formula C10H14N2O5S3 and a molecular weight of 338.4 g/mol. IUPAC name: 2-(3-methoxypropyl)-1,1-dioxothieno[3,2-e]thiazine-6-sulfonamide. InChIKey: JBRXWXADWNHGER-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O5S3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 2-(3-methoxypropyl)-1,1-dioxothieno[3,2-e]thiazine-6-sulfonamide |
| InChIKey | JBRXWXADWNHGER-UHFFFAOYSA-N |
| SMILES | COCCCN1C=CC2=C(S1(=O)=O)SC(=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)