CAS 199734-59-3 is the registry number for rac-cis N-Desethyl N-Acetyl Dorzolamide. Offered by: TRC. Available pack sizes: 100mg.
N-[(4R,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide (CAS 199734-59-3) is a chemical compound with the molecular formula C10H14N2O5S3 and a molecular weight of 338.4 g/mol. IUPAC name: N-[(4R,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide. InChIKey: MQRCTNZVQVRCRD-YLWLKBPMSA-N.
| Molecular formula | C10H14N2O5S3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | N-[(4R,6S)-6-methyl-7,7-dioxo-2-sulfamoyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-yl]acetamide |
| InChIKey | MQRCTNZVQVRCRD-YLWLKBPMSA-N |
| SMILES | C[C@H]1C[C@H](C2=C(S1(=O)=O)SC(=C2)S(=O)(=O)N)NC(=O)C |
Computed by PubChem (NCBI)