Products 1712829-94-1
CAS 1712829-94-1 is the registry number for 1-[(3,5-Dimethylphenyl)methyl]-5,6-dimethyl-1H-benzimidazole, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazole (CAS 1712829-94-1) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: 1-[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazole. InChIKey: NPUGJLHOTXGTCE-UHFFFAOYSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 1-[(3,5-dimethylphenyl)methyl]-5,6-dimethylbenzimidazole |
| InChIKey | NPUGJLHOTXGTCE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)CN2C=NC3=C2C=C(C(=C3)C)C)C |
Computed by PubChem (NCBI)