CAS 21399-33-7 appears in our catalog under these names: 4-Methylacetophenone azine, 95%, 4--Methylacetophenone azine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg, 5000mg.
(E)-1-(4-methylphenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]ethanimine (CAS 21399-33-7) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: (E)-1-(4-methylphenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]ethanimine. InChIKey: JVDVHQDNGONESM-MXWIWYRXSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | (E)-1-(4-methylphenyl)-N-[(E)-1-(4-methylphenyl)ethylideneamino]ethanimine |
| InChIKey | JVDVHQDNGONESM-MXWIWYRXSA-N |
| SMILES | CC1=CC=C(C=C1)/C(=N/N=C(/C2=CC=C(C=C2)C)\C)/C |
Computed by PubChem (NCBI)