CAS 78684-63-6 appears in our catalog under these names: (R)-Mianserin, (R)-(+)-Mianserin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(7R)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene (CAS 78684-63-6) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: (7R)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene. InChIKey: UEQUQVLFIPOEMF-SFHVURJKSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | (7R)-5-methyl-2,5-diazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),8,10,12,15,17-hexaene |
| InChIKey | UEQUQVLFIPOEMF-SFHVURJKSA-N |
| SMILES | CN1CCN2[C@@H](C1)C3=CC=CC=C3CC4=CC=CC=C42 |
Computed by PubChem (NCBI)