CAS 1713015-63-4 is the registry number for (2,5-Dibromophenyl)(4-ethoxyphenyl)methanone, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,5-dibromophenyl)-(4-ethoxyphenyl)methanone (CAS 1713015-63-4) is a chemical compound with the molecular formula C15H12Br2O2 and a molecular weight of 384.06 g/mol. IUPAC name: (2,5-dibromophenyl)-(4-ethoxyphenyl)methanone. InChIKey: CRYYKXXSXDHJCQ-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2O2 |
|---|---|
| Molecular weight | 384.06 g/mol |
| IUPAC name | (2,5-dibromophenyl)-(4-ethoxyphenyl)methanone |
| InChIKey | CRYYKXXSXDHJCQ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Br)Br |
Computed by PubChem (NCBI)