CAS 17136-25-3 appears in our catalog under these names: H–β–Ala–Leu–OH, H-β-Ala-Leu-OH, H-beta-Ala-Leu-OH, Excitin 1. Offered by: GLPBio, Creative Peptides, Biosynth, MedChemExpress. Available pack sizes: 25g, on request, 5g, 10000mg, 5000mg, Get quote.
(2S)-2-(3-aminopropanoylamino)-4-methylpentanoic acid (CAS 17136-25-3) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-4-methylpentanoic acid. InChIKey: YVFFCSSMTOXAQS-ZETCQYMHSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-4-methylpentanoic acid |
| InChIKey | YVFFCSSMTOXAQS-ZETCQYMHSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)