CAS 1715016-76-4 appears in our catalog under these names: FUB-AMB, FUB-AMB (1.0 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 100mg, 10mg, 1mg, 5x1ml.
Methyl 2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoate (CAS 1715016-76-4) is a chemical compound with the molecular formula C21H22FN3O3 and a molecular weight of 383.4 g/mol. IUPAC name: methyl 2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoate. InChIKey: FRFFLYJQPCIIQB-UHFFFAOYSA-N.
| Molecular formula | C21H22FN3O3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | methyl 2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoate |
| InChIKey | FRFFLYJQPCIIQB-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)OC)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)