CAS 2693397-47-4 appears in our catalog under these names: MDMB-FUBINACA Metabolite M1, MDMB–FUBINACA metabolite M1. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 5 mg, 1 mg.
(2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2693397-47-4) is a chemical compound with the molecular formula C21H22FN3O3 and a molecular weight of 383.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: IYHKZKWEKNIMPG-GOSISDBHSA-N.
| Molecular formula | C21H22FN3O3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-fluorophenyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | IYHKZKWEKNIMPG-GOSISDBHSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)