CAS 171618-77-2 appears in our catalog under these names: 6-(2-Chloroethyl)-5-methyl-(1,2,4)triazolo(1,5-a)pyrimidin-7-ol, 95%, 6-(2-Chloroethyl)-5-methyl-(1,2,4)triazolo(1,5-a)pyrimidin-7-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-(2-chloroethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 171618-77-2) is a chemical compound with the molecular formula C8H9ClN4O and a molecular weight of 212.63 g/mol. IUPAC name: 6-(2-chloroethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: NKEJETGTPDKPPY-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 6-(2-chloroethyl)-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | NKEJETGTPDKPPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)N=CN2)CCCl |
Computed by PubChem (NCBI)