CAS 887833-37-6 is the registry number for 7-Chloro-N5,N5-dimethylbenzo[c][1,2,5]oxadiazole-4,5-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-5-N,5-N-dimethyl-2,1,3-benzoxadiazole-4,5-diamine (CAS 887833-37-6) is a chemical compound with the molecular formula C8H9ClN4O and a molecular weight of 212.63 g/mol. IUPAC name: 7-chloro-5-N,5-N-dimethyl-2,1,3-benzoxadiazole-4,5-diamine. InChIKey: UZRWNDUAEJYSCT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 7-chloro-5-N,5-N-dimethyl-2,1,3-benzoxadiazole-4,5-diamine |
| InChIKey | UZRWNDUAEJYSCT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C2=NON=C2C(=C1)Cl)N |
Computed by PubChem (NCBI)