CAS 17162-39-9 appears in our catalog under these names: (-)-Phenylephrine hydrogentartrate, 95%, (-)-Phenylephrine hydrogentartrate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2g, 10g, 25g.
2,3-dihydroxybutanedioic acid;3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol (CAS 17162-39-9) is a chemical compound with the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. IUPAC name: 2,3-dihydroxybutanedioic acid;3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol. InChIKey: NHKOTKKHHYKARN-FVGYRXGTSA-N.
| Molecular formula | C13H19NO8 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | 2,3-dihydroxybutanedioic acid;3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol |
| InChIKey | NHKOTKKHHYKARN-FVGYRXGTSA-N |
| SMILES | CNC[C@@H](C1=CC(=CC=C1)O)O.C(C(C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)