CAS 33402-03-8 appears in our catalog under these names: Metaraminol bitartrate, 95%, Metaraminol Bitartrate, Metaraminol Bitartrate, >95% (HPLC), Metaraminol tartrate/ 99.53% (existing batch purity), Metaraminol (tartrate). Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 100mg, on request, 10mg, 25mg, 50mg, 200mg, 1g, 500mg.
3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 33402-03-8) is a chemical compound with the molecular formula C13H19NO8 and a molecular weight of 317.29 g/mol. IUPAC name: 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: VENXSELNXQXCNT-IJYXXVHRSA-N.
| Molecular formula | C13H19NO8 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | 3-[(1R,2S)-2-amino-1-hydroxypropyl]phenol;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | VENXSELNXQXCNT-IJYXXVHRSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC=C1)O)O)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)