CAS 17177-63-8 is the registry number for p-Tolyl methanesulfonate, 98%. Offered by: AmBeed. Available pack sizes: 50mg.
(4-methylphenyl) methanesulfonate (CAS 17177-63-8) is a chemical compound with the molecular formula C8H10O3S and a molecular weight of 186.23 g/mol. IUPAC name: (4-methylphenyl) methanesulfonate. InChIKey: XUEGVQIJMFWBLO-UHFFFAOYSA-N.
| Molecular formula | C8H10O3S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | (4-methylphenyl) methanesulfonate |
| InChIKey | XUEGVQIJMFWBLO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OS(=O)(=O)C |
Computed by PubChem (NCBI)