CAS 172152-35-1 appears in our catalog under these names: Ilaprazole Impurity 9, Desoxy Ilaprazole, 2-(((4-Methoxy-3-methylpyridin-2-yl)methyl)thio)-6-(1H-pyrrol-1-yl)-1H-benzo[d]imidazole 97%, 2-(((4-Methoxy-3-methylpyridin-2-yl)methyl)thio)-6-(1H-pyrrol-1-yl)-1H-benzo[d]imidazole, 97%, 97%, Desoxy ilaprazole, min. 95 %, 100 mg. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 25mg, 100mg, 250mg, 500mg, 1g, 5g, 25g.
2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfanyl]-6-pyrrol-1-yl-1H-benzimidazole (CAS 172152-35-1) is a chemical compound with the molecular formula C19H18N4OS and a molecular weight of 350.4 g/mol. IUPAC name: 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfanyl]-6-pyrrol-1-yl-1H-benzimidazole. InChIKey: TZNQIYXOVOTIKQ-UHFFFAOYSA-N.
| Molecular formula | C19H18N4OS |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-[(4-methoxy-3-methyl-2-pyridinyl)methylsulfanyl]-6-pyrrol-1-yl-1H-benzimidazole |
| InChIKey | TZNQIYXOVOTIKQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CSC2=NC3=C(N2)C=C(C=C3)N4C=CC=C4)OC |
Computed by PubChem (NCBI)