CAS 2285346-40-7 appears in our catalog under these names: Ilaprazole Impurity 36, Ilaprazole Impurity 23, Pyridinium, 2-(mercaptomethyl)-4-methoxy-3-methyl-1-(6-(1H-pyrrol-1-yl)-1H-benzimidazol-2-yl)-, inner salt. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]methanethiolate (CAS 2285346-40-7) is a chemical compound with the molecular formula C19H18N4OS and a molecular weight of 350.4 g/mol. IUPAC name: [4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]methanethiolate. InChIKey: RNUKNDMAEHKCFJ-UHFFFAOYSA-N.
| Molecular formula | C19H18N4OS |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | [4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-yl]methanethiolate |
| InChIKey | RNUKNDMAEHKCFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C[S-])C2=NC3=C(N2)C=C(C=C3)N4C=CC=C4)OC |
Computed by PubChem (NCBI)