CAS 172155-07-6 appears in our catalog under these names: Perfluoro-3,7-dimethyloctanoic acid, 95%, Perfluoro-3,7-dimethyloctanoicacid, 97%, 2,2,3,4,4,5,5,6,6,7,8,8,8-Tridecafluoro-3,7-bis(trifluoromethyl)-octanoic Acid, >95% (HPLC), Perfluoro(3,7-bis(trifluoromethyl))octanoic acid, Perfluoro(3,7-dimethyloctanoic acid), ROTI®Star, 100 mg, glass ampoule. Offered by: Combi-blocks, AmBeed, TRC, Dr. Ehrenstorfer, Roth. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg, 500mg, 1x100mg.
2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octanoic acid (CAS 172155-07-6) is a chemical compound with the molecular formula C10HF19O2 and a molecular weight of 514.08 g/mol. IUPAC name: 2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octanoic acid. InChIKey: KZUSAXRVIONPJU-UHFFFAOYSA-N.
| Molecular formula | C10HF19O2 |
|---|---|
| Molecular weight | 514.08 g/mol |
| IUPAC name | 2,2,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3,7-bis(trifluoromethyl)octanoic acid |
| InChIKey | KZUSAXRVIONPJU-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(C(F)(F)F)F)(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)O |
Computed by PubChem (NCBI)