Products 960315-50-8

CAS 960315-50-8 is the registry number for Perfluorodecanoic acid 13C2 (1,2-13C2) 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2-13C2)decanoic acid (CAS 960315-50-8) is a chemical compound with the molecular formula C10HF19O2 and a molecular weight of 516.07 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2-13C2)decanoic acid. InChIKey: PCIUEQPBYFRTEM-ZDOIIHCHSA-N.

Identity
Molecular formulaC10HF19O2
Molecular weight516.07 g/mol
IUPAC name2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro(1,2-13C2)decanoic acid
InChIKeyPCIUEQPBYFRTEM-ZDOIIHCHSA-N
SMILES[13C](=O)([13C](C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O

Computed by PubChem (NCBI)