CAS 172330-01-7 is the registry number for (R)-Sodium α-ketoisocaproate-d3, 98.0%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg.
CAS 172330-01-7 identifies a chemical compound with the molecular formula C6H10NaO3 and a molecular weight of 156.15 g/mol. InChIKey: NVPLKQSQRQOWCP-DUNINJLOSA-N.
| Molecular formula | C6H10NaO3 |
|---|---|
| Molecular weight | 156.15 g/mol |
| InChIKey | NVPLKQSQRQOWCP-DUNINJLOSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C)CC(=O)C(=O)O.[Na] |
Computed by PubChem (NCBI)