CAS 2483736-09-8 appears in our catalog under these names: Sodium α–ketoisocaproic acid–13C2, Sodium α-ketoisocaproic acid-13C2, 98.1%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 5 mg, 10 mg.
CAS 2483736-09-8 identifies a chemical compound with the molecular formula C6H10NaO3 and a molecular weight of 155.12 g/mol. InChIKey: NVPLKQSQRQOWCP-IGQLHDOCSA-N.
| Molecular formula | C6H10NaO3 |
|---|---|
| Molecular weight | 155.12 g/mol |
| InChIKey | NVPLKQSQRQOWCP-IGQLHDOCSA-N |
| SMILES | CC(C)C[13C](=O)[13C](=O)O.[Na] |
Computed by PubChem (NCBI)