Products 17266-45-4
CAS 17266-45-4 is the registry number for 2-(5-Bromo-1-benzothiophen-3-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 0,5g, 1g.
2-(5-bromo-1-benzothiophen-3-yl)acetic acid (CAS 17266-45-4) is a chemical compound with the molecular formula C10H7BrO2S and a molecular weight of 271.13 g/mol. IUPAC name: 2-(5-bromo-1-benzothiophen-3-yl)acetic acid. InChIKey: ZCOAKUJOOQOKHY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO2S |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 2-(5-bromo-1-benzothiophen-3-yl)acetic acid |
| InChIKey | ZCOAKUJOOQOKHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CS2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(5-bromo-1-benzothiophen-3-yl)acetic acid, Benzo(b)thiophene-3-acetic acid, 5-bromo-, 5-Bromobenzo(b)thiophene-3-acetic acid, 5-18-06-00449 (Beilstein Handbook Reference), 5-Bromobenzo[b]thiophene-3-acetic acid, Benzo[b]thiophene-3-aceticacid, 5-bromo-, 2-(5-Bromobenzo[b]thiophen-3-yl)aceticacid, Oprea1_484512, 5-Brom-benzo[b]-thiophen-3-essigsaure, (5-bromo-1-benzothien-3-yl)acetic acid