CAS 1727-96-4 is the registry number for rac-(1R,2S,4S)-7-Oxabicyclo(2.2.1)heptane-2-carbonitrile, endo. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile (CAS 1727-96-4) is a chemical compound with the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. IUPAC name: (1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile. InChIKey: SOCKWJNQKNADLU-LYFYHCNISA-N.
| Molecular formula | C7H9NO |
|---|---|
| Molecular weight | 123.15 g/mol |
| IUPAC name | (1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile |
| InChIKey | SOCKWJNQKNADLU-LYFYHCNISA-N |
| SMILES | C1C[C@@H]2[C@@H](C[C@H]1O2)C#N |
Computed by PubChem (NCBI)