CAS 1727-97-5 is the registry number for Rel-(1R,2R,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile (CAS 1727-97-5) is a chemical compound with the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. IUPAC name: (1S,2S,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile. InChIKey: SOCKWJNQKNADLU-XVMARJQXSA-N.
| Molecular formula | C7H9NO |
|---|---|
| Molecular weight | 123.15 g/mol |
| IUPAC name | (1S,2S,4R)-7-oxabicyclo[2.2.1]heptane-2-carbonitrile |
| InChIKey | SOCKWJNQKNADLU-XVMARJQXSA-N |
| SMILES | C1C[C@H]2[C@@H](C[C@@H]1O2)C#N |
Computed by PubChem (NCBI)