CAS 172720-97-7 is the registry number for rel-N-((1R,4R)-4-(Hydroxymethyl)-2-cyclopenten-1-yl)carbamic Acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 100mg.
Tert-butyl N-[(1R,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate (CAS 172720-97-7) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl N-[(1R,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate. InChIKey: MVIWPMBRXBNBDX-IUCAKERBSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl N-[(1R,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate |
| InChIKey | MVIWPMBRXBNBDX-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](C=C1)CO |
Computed by PubChem (NCBI)