CAS 153011-43-9 appears in our catalog under these names: N-((1S,4R)-4-(hydroxymethyl)-2-cyclopenten-1-yl)-carbamic Acid 1,1-Dimethylethyl Ester, tert-Butyl N-((1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl)carbamate. Offered by: TRC, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
Tert-butyl N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate (CAS 153011-43-9) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate. InChIKey: MVIWPMBRXBNBDX-DTWKUNHWSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]carbamate |
| InChIKey | MVIWPMBRXBNBDX-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@H](C=C1)CO |
Computed by PubChem (NCBI)