CAS 17282-40-5 appears in our catalog under these names: 1–(2–Ethoxy–2–oxoethyl)pyridin–1–ium bromide, 1-(2-Ethoxy-2-oxoethyl)pyridin-1-ium bromide, 98%, 98%, 1-(2-Ethoxy-2-oxoethyl)pyridin-1-ium bromide, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg, 25g, 100g.
Ethyl 2-pyridin-1-ium-1-ylacetate bromide (CAS 17282-40-5) is a chemical compound with the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. IUPAC name: ethyl 2-pyridin-1-ium-1-ylacetate bromide. InChIKey: PXBOIFNOMWXDFC-UHFFFAOYSA-M.
| Molecular formula | C9H12BrNO2 |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | ethyl 2-pyridin-1-ium-1-ylacetate bromide |
| InChIKey | PXBOIFNOMWXDFC-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C[N+]1=CC=CC=C1.[Br-] |
Computed by PubChem (NCBI)