Products 72145-00-7

CAS 72145-00-7 is the registry number for 3-(3-Methyl-1h-pyrazol-1-yl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(3-methylpyrazol-1-yl)propanoic acid (CAS 72145-00-7) is a chemical compound with the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. IUPAC name: 3-(3-methylpyrazol-1-yl)propanoic acid. InChIKey: FPLLCFQUZAEVIE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10N2O2
Molecular weight154.17 g/mol
IUPAC name3-(3-methylpyrazol-1-yl)propanoic acid
InChIKeyFPLLCFQUZAEVIE-UHFFFAOYSA-N
SMILESCC1=NN(C=C1)CCC(=O)O

Computed by PubChem (NCBI)