CAS 172947-14-7 is the registry number for 2-Cyclopropyl-propylamine -p-toluenesulfonate salt. Offered by: Chemat. Available pack sizes: 10g, 2g.
2-cyclopropylpropan-2-amine;4-methylbenzenesulfonic acid (CAS 172947-14-7) is a chemical compound with the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. IUPAC name: 2-cyclopropylpropan-2-amine;4-methylbenzenesulfonic acid. InChIKey: RGWMDWPKOOWZSF-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3S |
|---|---|
| Molecular weight | 271.38 g/mol |
| IUPAC name | 2-cyclopropylpropan-2-amine;4-methylbenzenesulfonic acid |
| InChIKey | RGWMDWPKOOWZSF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)(C1CC1)N |
Computed by PubChem (NCBI)